About 3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate
3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate (PubChem CID 13132208) has the molecular formula C24H23Cl2NO5
and a molecular weight of 476.36 g/mol. Its IUPAC name is 3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate.
Molecular Properties
| Compound Name | 3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate |
| PubChem CID | 13132208 |
| Molecular Formula | C24H23Cl2NO5 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate |
| SMILES | CC(Oc1ccc(Oc2ncc(Cl)cc2Cl)cc1)C(=O)OCCCOCc1ccccc1 |
| InChI | InChI=1S/C24H23Cl2NO5/c1-17(24(28)30-13-5-12-29-16-18-6-3-2-4-7-18)31-20-8-10-21(11-9-20)32-23-22(26)14-19(25)15-27-23/h2-4,6-11,14-15,17H,5,12-13,16H2,1H3 |
| InChIKey | OSEHDZBQRCLREX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate?
The IUPAC name of 3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate (CID 13132208) is 3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate.
What is the SMILES notation for 3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate?
The canonical SMILES for 3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate is CC(Oc1ccc(Oc2ncc(Cl)cc2Cl)cc1)C(=O)OCCCOCc1ccccc1.
What is the InChIKey of 3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate?
The InChIKey is OSEHDZBQRCLREX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23Cl2NO5/c1-17(24(28)30-13-5-12-29-16-18-6-3-2-4-7-18)31-20-8-10-21(11-9-20)32-23-22(26)14-19(25)15-27-23/h2-4,6-11,14-15,17H,5,12-13,16H2,1H3.
What are the key properties of 3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate?
3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate has a molecular weight of 476.36 g/mol, XLogP of 6.10, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate is sourced from PubChem (CID 13132208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).