C24H23Cl2NO5 — CID 13132208
3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate (PubChem CID 13132208) has the molecular formula C24H23Cl2NO5 and a molecular weight of 476.36 g/mol. Its IUPAC name is 3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate.
| Compound Name | 3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 13132208 |
| Molecular Formula | C24H23Cl2NO5 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 3-phenylmethoxypropyl 2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoate |
| SMILES | CC(Oc1ccc(Oc2ncc(Cl)cc2Cl)cc1)C(=O)OCCCOCc1ccccc1 |
| InChI | InChI=1S/C24H23Cl2NO5/c1-17(24(28)30-13-5-12-29-16-18-6-3-2-4-7-18)31-20-8-10-21(11-9-20)32-23-22(26)14-19(25)15-27-23/h2-4,6-11,14-15,17H,5,12-13,16H2,1H3 |
| InChIKey | OSEHDZBQRCLREX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|