C20H13Cl4NO4 — CID 110193308
[3-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] 2-(3,5-dichlorophenoxy)propanoate (PubChem CID 110193308) has the molecular formula C20H13Cl4NO4 and a molecular weight of 473.14 g/mol. Its IUPAC name is [3-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] 2-(3,5-dichlorophenoxy)propanoate.
| Compound Name | [3-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] 2-(3,5-dichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 110193308 |
| Molecular Formula | C20H13Cl4NO4 |
| Molecular Weight | 473.14 g/mol |
| Exact Mass | 470.96 |
| IUPAC Name | [3-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] 2-(3,5-dichlorophenoxy)propanoate |
| SMILES | CC(Oc1cc(Cl)cc(Cl)c1)C(=O)Oc1cccc(Oc2ncc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C20H13Cl4NO4/c1-11(27-17-6-12(21)5-13(22)7-17)20(26)29-16-4-2-3-15(9-16)28-19-18(24)8-14(23)10-25-19/h2-11H,1H3 |
| InChIKey | ZHWXLQQHXGKOLH-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.14 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|