C15H13Cl2NO4 — CID 2427450
methyl (2S)-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]propanoate (PubChem CID 2427450) has the molecular formula C15H13Cl2NO4 and a molecular weight of 342.18 g/mol. Its IUPAC name is methyl (2S)-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]propanoate.
| Compound Name | methyl (2S)-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 2427450 |
| Molecular Formula | C15H13Cl2NO4 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | methyl (2S)-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]propanoate |
| SMILES | COC(=O)[C@H](C)Oc1ccc(Oc2nc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C15H13Cl2NO4/c1-9(15(19)20-2)21-10-3-5-11(6-4-10)22-14-12(16)7-8-13(17)18-14/h3-9H,1-2H3/t9-/m0/s1 |
| InChIKey | RHPBNWCDJSOARE-VIFPVBQESA-N |
| XLogP | 4.12 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|