C17H14ClN3O5 — CID 70540251
methyl 2-[4-[(7-chloro-4-oxido-1,2,4-benzotriazin-4-ium-3-yl)oxy]phenoxy]propanoate (PubChem CID 70540251) has the molecular formula C17H14ClN3O5 and a molecular weight of 375.77 g/mol. Its IUPAC name is methyl 2-[4-[(7-chloro-4-oxido-1,2,4-benzotriazin-4-ium-3-yl)oxy]phenoxy]propanoate.
| Compound Name | methyl 2-[4-[(7-chloro-4-oxido-1,2,4-benzotriazin-4-ium-3-yl)oxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 70540251 |
| Molecular Formula | C17H14ClN3O5 |
| Molecular Weight | 375.77 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | methyl 2-[4-[(7-chloro-4-oxido-1,2,4-benzotriazin-4-ium-3-yl)oxy]phenoxy]propanoate |
| SMILES | COC(=O)C(C)Oc1ccc(Oc2nnc3cc(Cl)ccc3[n+]2[O-])cc1 |
| InChI | InChI=1S/C17H14ClN3O5/c1-10(16(22)24-2)25-12-4-6-13(7-5-12)26-17-20-19-14-9-11(18)3-8-15(14)21(17)23/h3-10H,1-2H3 |
| InChIKey | JXWRMPQRXZSUIR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 97.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.77 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|