C16H12ClN3O5 — CID 70537526
2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)oxy]phenoxy]propanoic acid (PubChem CID 70537526) has the molecular formula C16H12ClN3O5 and a molecular weight of 361.74 g/mol. Its IUPAC name is 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)oxy]phenoxy]propanoic acid.
| Compound Name | 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)oxy]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 70537526 |
| Molecular Formula | C16H12ClN3O5 |
| Molecular Weight | 361.74 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)oxy]phenoxy]propanoic acid |
| SMILES | CC(Oc1ccc(Oc2nc3ccc(Cl)cc3[n+]([O-])n2)cc1)C(=O)O |
| InChI | InChI=1S/C16H12ClN3O5/c1-9(15(21)22)24-11-3-5-12(6-4-11)25-16-18-13-7-2-10(17)8-14(13)20(23)19-16/h2-9H,1H3,(H,21,22) |
| InChIKey | IBMGDHMONHKLCN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.74 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|