C21H24ClN5O4 — CID 70521860
2-(dimethylamino)ethyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate (PubChem CID 70521860) has the molecular formula C21H24ClN5O4 and a molecular weight of 445.91 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate.
| Compound Name | 2-(dimethylamino)ethyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate |
|---|---|
| PubChem CID | 70521860 |
| Molecular Formula | C21H24ClN5O4 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-[4-[(7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-yl)-methylamino]phenoxy]propanoate |
| SMILES | CC(Oc1ccc(N(C)c2nc3ccc(Cl)cc3[n+]([O-])n2)cc1)C(=O)OCCN(C)C |
| InChI | InChI=1S/C21H24ClN5O4/c1-14(20(28)30-12-11-25(2)3)31-17-8-6-16(7-9-17)26(4)21-23-18-10-5-15(22)13-19(18)27(29)24-21/h5-10,13-14H,11-12H2,1-4H3 |
| InChIKey | ZDDSMFQYNIPTGF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 94.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|