C13H18N4O2 — CID 24749500
2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]-N,N-dimethylethanamine (PubChem CID 24749500) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]-N,N-dimethylethanamine.
| Compound Name | 2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 24749500 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-[(3-ethyl-1-oxido-1,2,4-benzotriazin-1-ium-7-yl)oxy]-N,N-dimethylethanamine |
| SMILES | CCc1nc2ccc(OCCN(C)C)cc2[n+]([O-])n1 |
| InChI | InChI=1S/C13H18N4O2/c1-4-13-14-11-6-5-10(19-8-7-16(2)3)9-12(11)17(18)15-13/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | XAOQRLKKGHCQRA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 65.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|