C17H13ClN2O4 — CID 3246729
(2R)-2-[4-(7-chloroquinoxalin-2-yl)oxyphenoxy]propanoic acid (PubChem CID 3246729) has the molecular formula C17H13ClN2O4 and a molecular weight of 344.75 g/mol. Its IUPAC name is (2R)-2-[4-(7-chloroquinoxalin-2-yl)oxyphenoxy]propanoic acid.
| Compound Name | (2R)-2-[4-(7-chloroquinoxalin-2-yl)oxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 3246729 |
| Molecular Formula | C17H13ClN2O4 |
| Molecular Weight | 344.75 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | (2R)-2-[4-(7-chloroquinoxalin-2-yl)oxyphenoxy]propanoic acid |
| SMILES | C[C@@H](Oc1ccc(Oc2cnc3ccc(Cl)cc3n2)cc1)C(=O)O |
| InChI | InChI=1S/C17H13ClN2O4/c1-10(17(21)22)23-12-3-5-13(6-4-12)24-16-9-19-14-7-2-11(18)8-15(14)20-16/h2-10H,1H3,(H,21,22)/t10-/m1/s1 |
| InChIKey | NUQZXROIVGBRGR-SNVBAGLBSA-N |
| XLogP | 3.93 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.75 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |