C18H16N2O5 — CID 10807054
2-[4-(7-methoxyquinoxalin-2-yl)oxyphenoxy]propanoic acid (PubChem CID 10807054) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-[4-(7-methoxyquinoxalin-2-yl)oxyphenoxy]propanoic acid.
| Compound Name | 2-[4-(7-methoxyquinoxalin-2-yl)oxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 10807054 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-[4-(7-methoxyquinoxalin-2-yl)oxyphenoxy]propanoic acid |
| SMILES | COc1ccc2ncc(Oc3ccc(OC(C)C(=O)O)cc3)nc2c1 |
| InChI | InChI=1S/C18H16N2O5/c1-11(18(21)22)24-12-3-5-13(6-4-12)25-17-10-19-15-8-7-14(23-2)9-16(15)20-17/h3-11H,1-2H3,(H,21,22) |
| InChIKey | WPZYLMYSXFSEQX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |