C11H10F3N3O3 — CID 66724631
7-methoxyquinoxalin-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 66724631) has the molecular formula C11H10F3N3O3 and a molecular weight of 289.21 g/mol. Its IUPAC name is 7-methoxyquinoxalin-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 7-methoxyquinoxalin-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66724631 |
| Molecular Formula | C11H10F3N3O3 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 7-methoxyquinoxalin-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc2ncc(N)nc2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H9N3O.C2HF3O2/c1-13-6-2-3-7-8(4-6)12-9(10)5-11-7;3-2(4,5)1(6)7/h2-5H,1H3,(H2,10,12);(H,6,7) |
| InChIKey | DKJWBGHKXDXECN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |