About carbonic acid;quinoxalin-2-amine
carbonic acid;quinoxalin-2-amine (PubChem CID 174967362) has the molecular formula C9H9N3O3
and a molecular weight of 207.19 g/mol. Its IUPAC name is carbonic acid;quinoxalin-2-amine.
Molecular Properties
| Compound Name | carbonic acid;quinoxalin-2-amine |
| PubChem CID | 174967362 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | carbonic acid;quinoxalin-2-amine |
| SMILES | Nc1cnc2ccccc2n1.O=C(O)O |
| InChI | InChI=1S/C8H7N3.CH2O3/c9-8-5-10-6-3-1-2-4-7(6)11-8;2-1(3)4/h1-5H,(H2,9,11);(H2,2,3,4) |
| InChIKey | ZGXHSHTWJSTVJG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze carbonic acid;quinoxalin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;quinoxalin-2-amine?
The IUPAC name of carbonic acid;quinoxalin-2-amine (CID 174967362) is carbonic acid;quinoxalin-2-amine.
What is the SMILES notation for carbonic acid;quinoxalin-2-amine?
The canonical SMILES for carbonic acid;quinoxalin-2-amine is Nc1cnc2ccccc2n1.O=C(O)O.
What is the InChIKey of carbonic acid;quinoxalin-2-amine?
The InChIKey is ZGXHSHTWJSTVJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3.CH2O3/c9-8-5-10-6-3-1-2-4-7(6)11-8;2-1(3)4/h1-5H,(H2,9,11);(H2,2,3,4).
What are the key properties of carbonic acid;quinoxalin-2-amine?
carbonic acid;quinoxalin-2-amine has a molecular weight of 207.19 g/mol, XLogP of 1.43, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;quinoxalin-2-amine is sourced from PubChem (CID 174967362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).