About azane;quinoxalin-2-amine
azane;quinoxalin-2-amine (PubChem CID 172829613) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is azane;quinoxalin-2-amine.
Molecular Properties
| Compound Name | azane;quinoxalin-2-amine |
| PubChem CID | 172829613 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | azane;quinoxalin-2-amine |
| SMILES | N.Nc1cnc2ccccc2n1 |
| InChI | InChI=1S/C8H7N3.H3N/c9-8-5-10-6-3-1-2-4-7(6)11-8;/h1-5H,(H2,9,11);1H3 |
| InChIKey | VILVQYYKPMTFCR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;quinoxalin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;quinoxalin-2-amine?
The IUPAC name of azane;quinoxalin-2-amine (CID 172829613) is azane;quinoxalin-2-amine.
What is the SMILES notation for azane;quinoxalin-2-amine?
The canonical SMILES for azane;quinoxalin-2-amine is N.Nc1cnc2ccccc2n1.
What is the InChIKey of azane;quinoxalin-2-amine?
The InChIKey is VILVQYYKPMTFCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3.H3N/c9-8-5-10-6-3-1-2-4-7(6)11-8;/h1-5H,(H2,9,11);1H3.
What are the key properties of azane;quinoxalin-2-amine?
azane;quinoxalin-2-amine has a molecular weight of 162.20 g/mol, XLogP of 1.37, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;quinoxalin-2-amine is sourced from PubChem (CID 172829613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).