About quinoxalin-2-amine;2,2,2-trifluoroacetic acid
quinoxalin-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 174627542) has the molecular formula C10H8F3N3O2
and a molecular weight of 259.19 g/mol. Its IUPAC name is quinoxalin-2-amine;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | quinoxalin-2-amine;2,2,2-trifluoroacetic acid |
| PubChem CID | 174627542 |
| Molecular Formula | C10H8F3N3O2 |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | quinoxalin-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | Nc1cnc2ccccc2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H7N3.C2HF3O2/c9-8-5-10-6-3-1-2-4-7(6)11-8;3-2(4,5)1(6)7/h1-5H,(H2,9,11);(H,6,7) |
| InChIKey | PFMQOUNEVHFBIB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze quinoxalin-2-amine;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoxalin-2-amine;2,2,2-trifluoroacetic acid?
The IUPAC name of quinoxalin-2-amine;2,2,2-trifluoroacetic acid (CID 174627542) is quinoxalin-2-amine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for quinoxalin-2-amine;2,2,2-trifluoroacetic acid?
The canonical SMILES for quinoxalin-2-amine;2,2,2-trifluoroacetic acid is Nc1cnc2ccccc2n1.O=C(O)C(F)(F)F.
What is the InChIKey of quinoxalin-2-amine;2,2,2-trifluoroacetic acid?
The InChIKey is PFMQOUNEVHFBIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3.C2HF3O2/c9-8-5-10-6-3-1-2-4-7(6)11-8;3-2(4,5)1(6)7/h1-5H,(H2,9,11);(H,6,7).
What are the key properties of quinoxalin-2-amine;2,2,2-trifluoroacetic acid?
quinoxalin-2-amine;2,2,2-trifluoroacetic acid has a molecular weight of 259.19 g/mol, XLogP of 1.85, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinoxalin-2-amine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 174627542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).