C22H22ClN3O5 — CID 57291337
2-aminooxypent-2-enyl 2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate (PubChem CID 57291337) has the molecular formula C22H22ClN3O5 and a molecular weight of 443.89 g/mol. Its IUPAC name is 2-aminooxypent-2-enyl 2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate.
| Compound Name | 2-aminooxypent-2-enyl 2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate |
|---|---|
| PubChem CID | 57291337 |
| Molecular Formula | C22H22ClN3O5 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 2-aminooxypent-2-enyl 2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate |
| SMILES | CCC=C(COC(=O)C(C)Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1)ON |
| InChI | InChI=1S/C22H22ClN3O5/c1-3-4-18(31-24)13-28-22(27)14(2)29-16-6-8-17(9-7-16)30-21-12-25-20-11-15(23)5-10-19(20)26-21/h4-12,14H,3,13,24H2,1-2H3 |
| InChIKey | FKMDPOHOBKTNOX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 105.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|