C22H22ClN3O5 — CID 91372945
2-(prop-1-enylamino)oxyethyl (2R)-2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate (PubChem CID 91372945) has the molecular formula C22H22ClN3O5 and a molecular weight of 443.89 g/mol. Its IUPAC name is 2-(prop-1-enylamino)oxyethyl (2R)-2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate.
| Compound Name | 2-(prop-1-enylamino)oxyethyl (2R)-2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate |
|---|---|
| PubChem CID | 91372945 |
| Molecular Formula | C22H22ClN3O5 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 2-(prop-1-enylamino)oxyethyl (2R)-2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate |
| SMILES | CC=CNOCCOC(=O)[C@@H](C)Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1 |
| InChI | InChI=1S/C22H22ClN3O5/c1-3-10-25-29-12-11-28-22(27)15(2)30-17-5-7-18(8-6-17)31-21-14-24-20-13-16(23)4-9-19(20)26-21/h3-10,13-15,25H,11-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | LIJPFVUDULBELB-OAHLLOKOSA-N |
| XLogP | 4.44 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|