C24H25ClN2O4 — CID 57226897
4-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]pent-2-enyl 2,2-dimethylpropanoate (PubChem CID 57226897) has the molecular formula C24H25ClN2O4 and a molecular weight of 440.93 g/mol. Its IUPAC name is 4-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]pent-2-enyl 2,2-dimethylpropanoate.
| Compound Name | 4-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]pent-2-enyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 57226897 |
| Molecular Formula | C24H25ClN2O4 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 4-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]pent-2-enyl 2,2-dimethylpropanoate |
| SMILES | CC(C=CCOC(=O)C(C)(C)C)Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1 |
| InChI | InChI=1S/C24H25ClN2O4/c1-16(6-5-13-29-23(28)24(2,3)4)30-18-8-10-19(11-9-18)31-22-15-26-21-14-17(25)7-12-20(21)27-22/h5-12,14-16H,13H2,1-4H3 |
| InChIKey | HDUIOJJKFVYKQH-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|