C18H18Cl2O4 — CID 12767799
propan-2-yl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate (PubChem CID 12767799) has the molecular formula C18H18Cl2O4 and a molecular weight of 369.24 g/mol. Its IUPAC name is propan-2-yl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate.
| Compound Name | propan-2-yl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate |
|---|---|
| PubChem CID | 12767799 |
| Molecular Formula | C18H18Cl2O4 |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | propan-2-yl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate |
| SMILES | CC(C)OC(=O)C(C)Oc1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H18Cl2O4/c1-11(2)22-18(21)12(3)23-14-5-7-15(8-6-14)24-17-9-4-13(19)10-16(17)20/h4-12H,1-3H3 |
| InChIKey | CXLIMONXKCQUTC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |