About (1-phenylethenylamino)oxymethyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate
(1-phenylethenylamino)oxymethyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate (PubChem CID 57317198) has the molecular formula C24H21Cl2NO5
and a molecular weight of 474.34 g/mol. Its IUPAC name is (1-phenylethenylamino)oxymethyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate.
Molecular Properties
| Compound Name | (1-phenylethenylamino)oxymethyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate |
| PubChem CID | 57317198 |
| Molecular Formula | C24H21Cl2NO5 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | (1-phenylethenylamino)oxymethyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate |
| SMILES | C=C(NOCOC(=O)C(C)Oc1ccc(Oc2ccc(Cl)cc2Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H21Cl2NO5/c1-16(18-6-4-3-5-7-18)27-30-15-29-24(28)17(2)31-20-9-11-21(12-10-20)32-23-13-8-19(25)14-22(23)26/h3-14,17,27H,1,15H2,2H3 |
| InChIKey | QGSZBGPXRWOLRG-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-phenylethenylamino)oxymethyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-phenylethenylamino)oxymethyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate?
The IUPAC name of (1-phenylethenylamino)oxymethyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate (CID 57317198) is (1-phenylethenylamino)oxymethyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate.
What is the SMILES notation for (1-phenylethenylamino)oxymethyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate?
The canonical SMILES for (1-phenylethenylamino)oxymethyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate is C=C(NOCOC(=O)C(C)Oc1ccc(Oc2ccc(Cl)cc2Cl)cc1)c1ccccc1.
What is the InChIKey of (1-phenylethenylamino)oxymethyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate?
The InChIKey is QGSZBGPXRWOLRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21Cl2NO5/c1-16(18-6-4-3-5-7-18)27-30-15-29-24(28)17(2)31-20-9-11-21(12-10-20)32-23-13-8-19(25)14-22(23)26/h3-14,17,27H,1,15H2,2H3.
What are the key properties of (1-phenylethenylamino)oxymethyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate?
(1-phenylethenylamino)oxymethyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate has a molecular weight of 474.34 g/mol, XLogP of 6.25, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-phenylethenylamino)oxymethyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate is sourced from PubChem (CID 57317198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).