C17H14Cl2O4 — CID 1336816
phenacyl (2R)-2-(2,4-dichlorophenoxy)propanoate (PubChem CID 1336816) has the molecular formula C17H14Cl2O4 and a molecular weight of 353.20 g/mol. Its IUPAC name is phenacyl (2R)-2-(2,4-dichlorophenoxy)propanoate.
| Compound Name | phenacyl (2R)-2-(2,4-dichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 1336816 |
| Molecular Formula | C17H14Cl2O4 |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | phenacyl (2R)-2-(2,4-dichlorophenoxy)propanoate |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H14Cl2O4/c1-11(23-16-8-7-13(18)9-14(16)19)17(21)22-10-15(20)12-5-3-2-4-6-12/h2-9,11H,10H2,1H3/t11-/m1/s1 |
| InChIKey | BWRLNIHXDZOJCJ-LLVKDONJSA-N |
| XLogP | 4.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |