C11H11Cl2NO4 — CID 7862593
(2-amino-2-oxoethyl) (2R)-2-(2,4-dichlorophenoxy)propanoate (PubChem CID 7862593) has the molecular formula C11H11Cl2NO4 and a molecular weight of 292.12 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (2R)-2-(2,4-dichlorophenoxy)propanoate.
| Compound Name | (2-amino-2-oxoethyl) (2R)-2-(2,4-dichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 7862593 |
| Molecular Formula | C11H11Cl2NO4 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | (2-amino-2-oxoethyl) (2R)-2-(2,4-dichlorophenoxy)propanoate |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)OCC(N)=O |
| InChI | InChI=1S/C11H11Cl2NO4/c1-6(11(16)17-5-10(14)15)18-9-3-2-7(12)4-8(9)13/h2-4,6H,5H2,1H3,(H2,14,15)/t6-/m1/s1 |
| InChIKey | RKFZITZBENBGGZ-ZCFIWIBFSA-N |
| XLogP | 1.79 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |