C12H14Cl2O5 — CID 90904922
2,3-dihydroxypropyl 2-(2,4-dichlorophenoxy)propanoate (PubChem CID 90904922) has the molecular formula C12H14Cl2O5 and a molecular weight of 309.15 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-(2,4-dichlorophenoxy)propanoate.
| Compound Name | 2,3-dihydroxypropyl 2-(2,4-dichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 90904922 |
| Molecular Formula | C12H14Cl2O5 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 2,3-dihydroxypropyl 2-(2,4-dichlorophenoxy)propanoate |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)OCC(O)CO |
| InChI | InChI=1S/C12H14Cl2O5/c1-7(12(17)18-6-9(16)5-15)19-11-3-2-8(13)4-10(11)14/h2-4,7,9,15-16H,5-6H2,1H3 |
| InChIKey | GTIISEQIZIBXIE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |