C14H17Cl2NO5 — CID 7862378
[2-(2-methoxyethylamino)-2-oxoethyl] (2S)-2-(2,4-dichlorophenoxy)propanoate (PubChem CID 7862378) has the molecular formula C14H17Cl2NO5 and a molecular weight of 350.20 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] (2S)-2-(2,4-dichlorophenoxy)propanoate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] (2S)-2-(2,4-dichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 7862378 |
| Molecular Formula | C14H17Cl2NO5 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] (2S)-2-(2,4-dichlorophenoxy)propanoate |
| SMILES | COCCNC(=O)COC(=O)[C@H](C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl2NO5/c1-9(22-12-4-3-10(15)7-11(12)16)14(19)21-8-13(18)17-5-6-20-2/h3-4,7,9H,5-6,8H2,1-2H3,(H,17,18)/t9-/m0/s1 |
| InChIKey | SJFDXMPXAGGWDG-VIFPVBQESA-N |
| XLogP | 2.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|