C15H14Cl2O3 — CID 12804883
2-[4-(2,4-dichlorophenoxy)phenoxy]propan-1-ol (PubChem CID 12804883) has the molecular formula C15H14Cl2O3 and a molecular weight of 313.18 g/mol. Its IUPAC name is 2-[4-(2,4-dichlorophenoxy)phenoxy]propan-1-ol.
| Compound Name | 2-[4-(2,4-dichlorophenoxy)phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 12804883 |
| Molecular Formula | C15H14Cl2O3 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-[4-(2,4-dichlorophenoxy)phenoxy]propan-1-ol |
| SMILES | CC(CO)Oc1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H14Cl2O3/c1-10(9-18)19-12-3-5-13(6-4-12)20-15-7-2-11(16)8-14(15)17/h2-8,10,18H,9H2,1H3 |
| InChIKey | XXTUBDMAPZYHMX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |