C15H12Cl2O3 — CID 67553768
[4-(2,4-dichlorophenoxy)phenyl] propanoate (PubChem CID 67553768) has the molecular formula C15H12Cl2O3 and a molecular weight of 311.16 g/mol. Its IUPAC name is [4-(2,4-dichlorophenoxy)phenyl] propanoate.
| Compound Name | [4-(2,4-dichlorophenoxy)phenyl] propanoate |
|---|---|
| PubChem CID | 67553768 |
| Molecular Formula | C15H12Cl2O3 |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | [4-(2,4-dichlorophenoxy)phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H12Cl2O3/c1-2-15(18)20-12-6-4-11(5-7-12)19-14-8-3-10(16)9-13(14)17/h3-9H,2H2,1H3 |
| InChIKey | GUDHFHRTLPWDFL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|