C17H19Cl2NO — CID 170865611
3-[4-(2,4-dichlorophenoxy)phenyl]-N,N-dimethylpropan-1-amine (PubChem CID 170865611) has the molecular formula C17H19Cl2NO and a molecular weight of 324.25 g/mol. Its IUPAC name is 3-[4-(2,4-dichlorophenoxy)phenyl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[4-(2,4-dichlorophenoxy)phenyl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170865611 |
| Molecular Formula | C17H19Cl2NO |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 3-[4-(2,4-dichlorophenoxy)phenyl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCc1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H19Cl2NO/c1-20(2)11-3-4-13-5-8-15(9-6-13)21-17-10-7-14(18)12-16(17)19/h5-10,12H,3-4,11H2,1-2H3 |
| InChIKey | IQCBAOXVSNPQAX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |