C13H20ClNO — CID 170866526
3-(3-chloro-4-ethoxyphenyl)-N,N-dimethylpropan-1-amine (PubChem CID 170866526) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is 3-(3-chloro-4-ethoxyphenyl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(3-chloro-4-ethoxyphenyl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170866526 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 3-(3-chloro-4-ethoxyphenyl)-N,N-dimethylpropan-1-amine |
| SMILES | CCOc1ccc(CCCN(C)C)cc1Cl |
| InChI | InChI=1S/C13H20ClNO/c1-4-16-13-8-7-11(10-12(13)14)6-5-9-15(2)3/h7-8,10H,4-6,9H2,1-3H3 |
| InChIKey | YWUZJNKWJUUYLE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |