C11H15BrClNO — CID 115262221
N-(bromomethyl)-2-(3-chloro-4-ethoxyphenyl)ethanamine (PubChem CID 115262221) has the molecular formula C11H15BrClNO and a molecular weight of 292.60 g/mol. Its IUPAC name is N-(bromomethyl)-2-(3-chloro-4-ethoxyphenyl)ethanamine.
| Compound Name | N-(bromomethyl)-2-(3-chloro-4-ethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 115262221 |
| Molecular Formula | C11H15BrClNO |
| Molecular Weight | 292.60 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | N-(bromomethyl)-2-(3-chloro-4-ethoxyphenyl)ethanamine |
| SMILES | CCOc1ccc(CCNCBr)cc1Cl |
| InChI | InChI=1S/C11H15BrClNO/c1-2-15-11-4-3-9(7-10(11)13)5-6-14-8-12/h3-4,7,14H,2,5-6,8H2,1H3 |
| InChIKey | JOGYQIRTCAHLJF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.60 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|