C16H14Cl2O4 — CID 67627355
(2S)-2-[4-(2,4-dichlorophenoxy)phenoxy]butanoic acid (PubChem CID 67627355) has the molecular formula C16H14Cl2O4 and a molecular weight of 341.19 g/mol. Its IUPAC name is (2S)-2-[4-(2,4-dichlorophenoxy)phenoxy]butanoic acid.
| Compound Name | (2S)-2-[4-(2,4-dichlorophenoxy)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 67627355 |
| Molecular Formula | C16H14Cl2O4 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | (2S)-2-[4-(2,4-dichlorophenoxy)phenoxy]butanoic acid |
| SMILES | CC[C@H](Oc1ccc(Oc2ccc(Cl)cc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C16H14Cl2O4/c1-2-14(16(19)20)21-11-4-6-12(7-5-11)22-15-8-3-10(17)9-13(15)18/h3-9,14H,2H2,1H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | QCXMBVFCOYNXOG-AWEZNQCLSA-N |
| XLogP | 5.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |