C18H16Cl2O6 — CID 90997814
2-(4-chloro-2-methylphenoxy)-4-(4-chlorophenoxy)pentanedioic acid (PubChem CID 90997814) has the molecular formula C18H16Cl2O6 and a molecular weight of 399.23 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-4-(4-chlorophenoxy)pentanedioic acid.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-4-(4-chlorophenoxy)pentanedioic acid |
|---|---|
| PubChem CID | 90997814 |
| Molecular Formula | C18H16Cl2O6 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-4-(4-chlorophenoxy)pentanedioic acid |
| SMILES | Cc1cc(Cl)ccc1OC(CC(Oc1ccc(Cl)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C18H16Cl2O6/c1-10-8-12(20)4-7-14(10)26-16(18(23)24)9-15(17(21)22)25-13-5-2-11(19)3-6-13/h2-8,15-16H,9H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | YOAQJWAAQVOZRE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |