C19H19Cl2FO3 — CID 70456934
1-(4-chloro-2-methylphenoxy)-1-(4-chlorophenoxy)-4-fluoro-3,3-dimethylbutan-2-one (PubChem CID 70456934) has the molecular formula C19H19Cl2FO3 and a molecular weight of 385.26 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenoxy)-1-(4-chlorophenoxy)-4-fluoro-3,3-dimethylbutan-2-one.
| Compound Name | 1-(4-chloro-2-methylphenoxy)-1-(4-chlorophenoxy)-4-fluoro-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 70456934 |
| Molecular Formula | C19H19Cl2FO3 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 1-(4-chloro-2-methylphenoxy)-1-(4-chlorophenoxy)-4-fluoro-3,3-dimethylbutan-2-one |
| SMILES | Cc1cc(Cl)ccc1OC(Oc1ccc(Cl)cc1)C(=O)C(C)(C)CF |
| InChI | InChI=1S/C19H19Cl2FO3/c1-12-10-14(21)6-9-16(12)25-18(17(23)19(2,3)11-22)24-15-7-4-13(20)5-8-15/h4-10,18H,11H2,1-3H3 |
| InChIKey | WLBUDRIXCOGFQH-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|