C21H16Cl2O4 — CID 133241354
2-(4-chlorophenoxy)-3-(5-chloro-2-phenoxyphenyl)propanoic acid (PubChem CID 133241354) has the molecular formula C21H16Cl2O4 and a molecular weight of 403.26 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-3-(5-chloro-2-phenoxyphenyl)propanoic acid.
| Compound Name | 2-(4-chlorophenoxy)-3-(5-chloro-2-phenoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 133241354 |
| Molecular Formula | C21H16Cl2O4 |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 2-(4-chlorophenoxy)-3-(5-chloro-2-phenoxyphenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1cc(Cl)ccc1Oc1ccccc1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16Cl2O4/c22-15-6-9-18(10-7-15)27-20(21(24)25)13-14-12-16(23)8-11-19(14)26-17-4-2-1-3-5-17/h1-12,20H,13H2,(H,24,25) |
| InChIKey | GIDWTKVEMGZEDI-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |