C18H19ClO4 — CID 100550485
(2S)-3-(5-chloro-2-phenoxyphenyl)-2-propoxypropanoic acid (PubChem CID 100550485) has the molecular formula C18H19ClO4 and a molecular weight of 334.80 g/mol. Its IUPAC name is (2S)-3-(5-chloro-2-phenoxyphenyl)-2-propoxypropanoic acid.
| Compound Name | (2S)-3-(5-chloro-2-phenoxyphenyl)-2-propoxypropanoic acid |
|---|---|
| PubChem CID | 100550485 |
| Molecular Formula | C18H19ClO4 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (2S)-3-(5-chloro-2-phenoxyphenyl)-2-propoxypropanoic acid |
| SMILES | CCCO[C@@H](Cc1cc(Cl)ccc1Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H19ClO4/c1-2-10-22-17(18(20)21)12-13-11-14(19)8-9-16(13)23-15-6-4-3-5-7-15/h3-9,11,17H,2,10,12H2,1H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | XMFGIQDSDDZBQM-KRWDZBQOSA-N |
| XLogP | 4.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |