C23H19Cl2NO4 — CID 4066862
benzyl 2-[4-[(2,5-dichlorophenyl)carbamoyl]phenoxy]propanoate (PubChem CID 4066862) has the molecular formula C23H19Cl2NO4 and a molecular weight of 444.31 g/mol. Its IUPAC name is benzyl 2-[4-[(2,5-dichlorophenyl)carbamoyl]phenoxy]propanoate.
| Compound Name | benzyl 2-[4-[(2,5-dichlorophenyl)carbamoyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 4066862 |
| Molecular Formula | C23H19Cl2NO4 |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | benzyl 2-[4-[(2,5-dichlorophenyl)carbamoyl]phenoxy]propanoate |
| SMILES | CC(Oc1ccc(C(=O)Nc2cc(Cl)ccc2Cl)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H19Cl2NO4/c1-15(23(28)29-14-16-5-3-2-4-6-16)30-19-10-7-17(8-11-19)22(27)26-21-13-18(24)9-12-20(21)25/h2-13,15H,14H2,1H3,(H,26,27) |
| InChIKey | XZTXVVOWVJSITK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |