C25H24ClNO4 — CID 4231696
(2-chlorophenyl)methyl 2-[4-[(2-ethylphenyl)carbamoyl]phenoxy]propanoate (PubChem CID 4231696) has the molecular formula C25H24ClNO4 and a molecular weight of 437.92 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 2-[4-[(2-ethylphenyl)carbamoyl]phenoxy]propanoate.
| Compound Name | (2-chlorophenyl)methyl 2-[4-[(2-ethylphenyl)carbamoyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 4231696 |
| Molecular Formula | C25H24ClNO4 |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | (2-chlorophenyl)methyl 2-[4-[(2-ethylphenyl)carbamoyl]phenoxy]propanoate |
| SMILES | CCc1ccccc1NC(=O)c1ccc(OC(C)C(=O)OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C25H24ClNO4/c1-3-18-8-5-7-11-23(18)27-24(28)19-12-14-21(15-13-19)31-17(2)25(29)30-16-20-9-4-6-10-22(20)26/h4-15,17H,3,16H2,1-2H3,(H,27,28) |
| InChIKey | FWLIFHILOLRTHV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |