C23H19ClFNO4 — CID 3254737
(2-chlorophenyl)methyl 2-[4-[(4-fluorophenyl)carbamoyl]phenoxy]propanoate (PubChem CID 3254737) has the molecular formula C23H19ClFNO4 and a molecular weight of 427.86 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 2-[4-[(4-fluorophenyl)carbamoyl]phenoxy]propanoate.
| Compound Name | (2-chlorophenyl)methyl 2-[4-[(4-fluorophenyl)carbamoyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 3254737 |
| Molecular Formula | C23H19ClFNO4 |
| Molecular Weight | 427.86 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | (2-chlorophenyl)methyl 2-[4-[(4-fluorophenyl)carbamoyl]phenoxy]propanoate |
| SMILES | CC(Oc1ccc(C(=O)Nc2ccc(F)cc2)cc1)C(=O)OCc1ccccc1Cl |
| InChI | InChI=1S/C23H19ClFNO4/c1-15(23(28)29-14-17-4-2-3-5-21(17)24)30-20-12-6-16(7-13-20)22(27)26-19-10-8-18(25)9-11-19/h2-13,15H,14H2,1H3,(H,26,27) |
| InChIKey | XFTSHADAIGMNRZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.86 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |