C23H29NO4 — CID 4229182
pentyl 2-[4-[(2-ethylphenyl)carbamoyl]phenoxy]propanoate (PubChem CID 4229182) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is pentyl 2-[4-[(2-ethylphenyl)carbamoyl]phenoxy]propanoate.
| Compound Name | pentyl 2-[4-[(2-ethylphenyl)carbamoyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 4229182 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | pentyl 2-[4-[(2-ethylphenyl)carbamoyl]phenoxy]propanoate |
| SMILES | CCCCCOC(=O)C(C)Oc1ccc(C(=O)Nc2ccccc2CC)cc1 |
| InChI | InChI=1S/C23H29NO4/c1-4-6-9-16-27-23(26)17(3)28-20-14-12-19(13-15-20)22(25)24-21-11-8-7-10-18(21)5-2/h7-8,10-15,17H,4-6,9,16H2,1-3H3,(H,24,25) |
| InChIKey | NSGSJNZJZVIEMH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|