C20H21Cl2NO4 — CID 4064798
2-methylpropyl 2-[4-[(2,5-dichlorophenyl)carbamoyl]phenoxy]propanoate (PubChem CID 4064798) has the molecular formula C20H21Cl2NO4 and a molecular weight of 410.30 g/mol. Its IUPAC name is 2-methylpropyl 2-[4-[(2,5-dichlorophenyl)carbamoyl]phenoxy]propanoate.
| Compound Name | 2-methylpropyl 2-[4-[(2,5-dichlorophenyl)carbamoyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 4064798 |
| Molecular Formula | C20H21Cl2NO4 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-methylpropyl 2-[4-[(2,5-dichlorophenyl)carbamoyl]phenoxy]propanoate |
| SMILES | CC(C)COC(=O)C(C)Oc1ccc(C(=O)Nc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C20H21Cl2NO4/c1-12(2)11-26-20(25)13(3)27-16-7-4-14(5-8-16)19(24)23-18-10-15(21)6-9-17(18)22/h4-10,12-13H,11H2,1-3H3,(H,23,24) |
| InChIKey | LCIDWCJAIOWRIE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |