C23H19Cl2NO3 — CID 2071959
[4-[(2,5-dichlorophenyl)carbamoyl]phenyl] 4-propan-2-ylbenzoate (PubChem CID 2071959) has the molecular formula C23H19Cl2NO3 and a molecular weight of 428.32 g/mol. Its IUPAC name is [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] 4-propan-2-ylbenzoate.
| Compound Name | [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] 4-propan-2-ylbenzoate |
|---|---|
| PubChem CID | 2071959 |
| Molecular Formula | C23H19Cl2NO3 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] 4-propan-2-ylbenzoate |
| SMILES | CC(C)c1ccc(C(=O)Oc2ccc(C(=O)Nc3cc(Cl)ccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C23H19Cl2NO3/c1-14(2)15-3-5-17(6-4-15)23(28)29-19-10-7-16(8-11-19)22(27)26-21-13-18(24)9-12-20(21)25/h3-14H,1-2H3,(H,26,27) |
| InChIKey | NWTPCVVSQRHMMR-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|