C23H17Cl2NO4 — CID 19181724
[4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 19181724) has the molecular formula C23H17Cl2NO4 and a molecular weight of 442.30 g/mol. Its IUPAC name is [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19181724 |
| Molecular Formula | C23H17Cl2NO4 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)Oc2ccc(C(=O)Nc3cc(Cl)ccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C23H17Cl2NO4/c1-29-18-8-2-15(3-9-18)4-13-22(27)30-19-10-5-16(6-11-19)23(28)26-21-14-17(24)7-12-20(21)25/h2-14H,1H3,(H,26,28)/b13-4+ |
| InChIKey | NRTCBNXRHJZVEE-YIXHJXPBSA-N |
| XLogP | 5.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|