C29H21Cl2NO4 — CID 19181830
[4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate (PubChem CID 19181830) has the molecular formula C29H21Cl2NO4 and a molecular weight of 518.40 g/mol. Its IUPAC name is [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate.
| Compound Name | [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19181830 |
| Molecular Formula | C29H21Cl2NO4 |
| Molecular Weight | 518.40 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(OCc2ccccc2)cc1)Oc1ccc(C(=O)Nc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C29H21Cl2NO4/c30-23-11-16-26(31)27(18-23)32-29(34)22-9-14-25(15-10-22)36-28(33)17-8-20-6-12-24(13-7-20)35-19-21-4-2-1-3-5-21/h1-18H,19H2,(H,32,34)/b17-8+ |
| InChIKey | JLKYCPKGCANOJV-CAOOACKPSA-N |
| XLogP | 7.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.40 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|