C26H23Cl2NO5 — CID 19207806
[4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate (PubChem CID 19207806) has the molecular formula C26H23Cl2NO5 and a molecular weight of 500.38 g/mol. Its IUPAC name is [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate.
| Compound Name | [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19207806 |
| Molecular Formula | C26H23Cl2NO5 |
| Molecular Weight | 500.38 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)Oc2ccc(C(=O)Nc3cc(Cl)ccc3Cl)cc2)ccc1OC(C)C |
| InChI | InChI=1S/C26H23Cl2NO5/c1-16(2)33-23-12-4-17(14-24(23)32-3)5-13-25(30)34-20-9-6-18(7-10-20)26(31)29-22-15-19(27)8-11-21(22)28/h4-16H,1-3H3,(H,29,31)/b13-5+ |
| InChIKey | IYOVVUZOFOHZCN-WLRTZDKTSA-N |
| XLogP | 6.66 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.38 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|