C24H18BrCl2NO4 — CID 19185393
[4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate (PubChem CID 19185393) has the molecular formula C24H18BrCl2NO4 and a molecular weight of 535.22 g/mol. Its IUPAC name is [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate.
| Compound Name | [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19185393 |
| Molecular Formula | C24H18BrCl2NO4 |
| Molecular Weight | 535.22 g/mol |
| Exact Mass | 532.98 |
| IUPAC Name | [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(Br)cc1/C=C/C(=O)Oc1ccc(C(=O)Nc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C24H18BrCl2NO4/c1-2-31-22-11-6-17(25)13-16(22)5-12-23(29)32-19-8-3-15(4-9-19)24(30)28-21-14-18(26)7-10-20(21)27/h3-14H,2H2,1H3,(H,28,30)/b12-5+ |
| InChIKey | PDHYDSDBZOPZBD-LFYBBSHMSA-N |
| XLogP | 7.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.22 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|