About (3-chlorophenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate
(3-chlorophenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate (PubChem CID 19185345) has the molecular formula C17H14BrClO3
and a molecular weight of 381.65 g/mol. Its IUPAC name is (3-chlorophenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | (3-chlorophenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate |
| PubChem CID | 19185345 |
| Molecular Formula | C17H14BrClO3 |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | (3-chlorophenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(Br)cc1/C=C/C(=O)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H14BrClO3/c1-2-21-16-8-7-13(18)10-12(16)6-9-17(20)22-15-5-3-4-14(19)11-15/h3-11H,2H2,1H3/b9-6+ |
| InChIKey | LDSWXNANDXSWKZ-RMKNXTFCSA-N |
| XLogP | 5.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-chlorophenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate?
The IUPAC name of (3-chlorophenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate (CID 19185345) is (3-chlorophenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate.
What is the SMILES notation for (3-chlorophenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate?
The canonical SMILES for (3-chlorophenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate is CCOc1ccc(Br)cc1/C=C/C(=O)Oc1cccc(Cl)c1.
What is the InChIKey of (3-chlorophenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate?
The InChIKey is LDSWXNANDXSWKZ-RMKNXTFCSA-N. The full InChI is InChI=1S/C17H14BrClO3/c1-2-21-16-8-7-13(18)10-12(16)6-9-17(20)22-15-5-3-4-14(19)11-15/h3-11H,2H2,1H3/b9-6+.
What are the key properties of (3-chlorophenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate?
(3-chlorophenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate has a molecular weight of 381.65 g/mol, XLogP of 5.12, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate is sourced from PubChem (CID 19185345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).