C19H19BrO3 — CID 19185323
(2,6-dimethylphenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate (PubChem CID 19185323) has the molecular formula C19H19BrO3 and a molecular weight of 375.26 g/mol. Its IUPAC name is (2,6-dimethylphenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate.
| Compound Name | (2,6-dimethylphenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19185323 |
| Molecular Formula | C19H19BrO3 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | (2,6-dimethylphenyl) (E)-3-(5-bromo-2-ethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(Br)cc1/C=C/C(=O)Oc1c(C)cccc1C |
| InChI | InChI=1S/C19H19BrO3/c1-4-22-17-10-9-16(20)12-15(17)8-11-18(21)23-19-13(2)6-5-7-14(19)3/h5-12H,4H2,1-3H3/b11-8+ |
| InChIKey | PSGVEMOFQWWJPX-DHZHZOJOSA-N |
| XLogP | 5.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|