C31H25Cl2NO5 — CID 19185117
[4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 19185117) has the molecular formula C31H25Cl2NO5 and a molecular weight of 562.45 g/mol. Its IUPAC name is [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enoate.
| Compound Name | [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19185117 |
| Molecular Formula | C31H25Cl2NO5 |
| Molecular Weight | 562.45 g/mol |
| Exact Mass | 561.11 |
| IUPAC Name | [4-[(2,5-dichlorophenyl)carbamoyl]phenyl] (E)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)Oc2ccc(C(=O)Nc3cc(Cl)ccc3Cl)cc2)ccc1OCc1ccccc1C |
| InChI | InChI=1S/C31H25Cl2NO5/c1-20-5-3-4-6-23(20)19-38-28-15-7-21(17-29(28)37-2)8-16-30(35)39-25-12-9-22(10-13-25)31(36)34-27-18-24(32)11-14-26(27)33/h3-18H,19H2,1-2H3,(H,34,36)/b16-8+ |
| InChIKey | WUYYXLREAHVKLY-LZYBPNLTSA-N |
| XLogP | 7.76 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.45 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|