C21H15BrCl2N2O3 — CID 1034731
4-[(3-bromobenzoyl)amino]-N-(2,5-dichlorophenyl)-3-methoxybenzamide (PubChem CID 1034731) has the molecular formula C21H15BrCl2N2O3 and a molecular weight of 494.17 g/mol. Its IUPAC name is 4-[(3-bromobenzoyl)amino]-N-(2,5-dichlorophenyl)-3-methoxybenzamide.
| Compound Name | 4-[(3-bromobenzoyl)amino]-N-(2,5-dichlorophenyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 1034731 |
| Molecular Formula | C21H15BrCl2N2O3 |
| Molecular Weight | 494.17 g/mol |
| Exact Mass | 491.96 |
| IUPAC Name | 4-[(3-bromobenzoyl)amino]-N-(2,5-dichlorophenyl)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2cc(Cl)ccc2Cl)ccc1NC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C21H15BrCl2N2O3/c1-29-19-10-13(21(28)26-18-11-15(23)6-7-16(18)24)5-8-17(19)25-20(27)12-3-2-4-14(22)9-12/h2-11H,1H3,(H,25,27)(H,26,28) |
| InChIKey | OERWFABALQZTAT-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.17 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |