C16H12Cl2O3 — CID 774847
(2,4-dichlorophenyl) 3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 774847) has the molecular formula C16H12Cl2O3 and a molecular weight of 323.18 g/mol. Its IUPAC name is (2,4-dichlorophenyl) 3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | (2,4-dichlorophenyl) 3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 774847 |
| Molecular Formula | C16H12Cl2O3 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | (2,4-dichlorophenyl) 3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H12Cl2O3/c1-20-13-6-2-11(3-7-13)4-9-16(19)21-15-8-5-12(17)10-14(15)18/h2-10H,1H3 |
| InChIKey | MHISMUZYNBFYBI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|