C15H9Cl2FO2 — CID 918157
(2,4-dichlorophenyl) 3-(4-fluorophenyl)prop-2-enoate (PubChem CID 918157) has the molecular formula C15H9Cl2FO2 and a molecular weight of 311.14 g/mol. Its IUPAC name is (2,4-dichlorophenyl) 3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | (2,4-dichlorophenyl) 3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 918157 |
| Molecular Formula | C15H9Cl2FO2 |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | (2,4-dichlorophenyl) 3-(4-fluorophenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(F)cc1)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H9Cl2FO2/c16-11-4-7-14(13(17)9-11)20-15(19)8-3-10-1-5-12(18)6-2-10/h1-9H |
| InChIKey | QEUAYKURHHFXBF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|