C16H9Cl2FO3 — CID 6231829
(2,4-dichloro-6-formylphenyl) (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 6231829) has the molecular formula C16H9Cl2FO3 and a molecular weight of 339.15 g/mol. Its IUPAC name is (2,4-dichloro-6-formylphenyl) (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | (2,4-dichloro-6-formylphenyl) (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6231829 |
| Molecular Formula | C16H9Cl2FO3 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | (2,4-dichloro-6-formylphenyl) (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | O=Cc1cc(Cl)cc(Cl)c1OC(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C16H9Cl2FO3/c17-12-7-11(9-20)16(14(18)8-12)22-15(21)6-3-10-1-4-13(19)5-2-10/h1-9H/b6-3+ |
| InChIKey | KIJXMHZCGDZJSI-ZZXKWVIFSA-N |
| XLogP | 4.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|