C13H12Cl2O3 — CID 91694976
(2,4-dichloro-6-formylphenyl) cyclopentanecarboxylate (PubChem CID 91694976) has the molecular formula C13H12Cl2O3 and a molecular weight of 287.14 g/mol. Its IUPAC name is (2,4-dichloro-6-formylphenyl) cyclopentanecarboxylate.
| Compound Name | (2,4-dichloro-6-formylphenyl) cyclopentanecarboxylate |
|---|---|
| PubChem CID | 91694976 |
| Molecular Formula | C13H12Cl2O3 |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | (2,4-dichloro-6-formylphenyl) cyclopentanecarboxylate |
| SMILES | O=Cc1cc(Cl)cc(Cl)c1OC(=O)C1CCCC1 |
| InChI | InChI=1S/C13H12Cl2O3/c14-10-5-9(7-16)12(11(15)6-10)18-13(17)8-3-1-2-4-8/h5-8H,1-4H2 |
| InChIKey | QKISNGLKPVKGMV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|